For research use only. Not for therapeutic Use.
FAAH-IN-6（Cat No.:I011132）is a selective inhibitor of the enzyme fatty acid amide hydrolase (FAAH), which plays a crucial role in the metabolism of endocannabinoids like anandamide. By inhibiting FAAH, FAAH-IN-6 increases the levels of these endocannabinoids, which are involved in regulating pain, mood, inflammation, and appetite. This compound has shown potential therapeutic benefits in various conditions, including chronic pain, anxiety, and inflammatory diseases. FAAH-IN-6 is currently under investigation for its ability to modulate the endocannabinoid system, offering a novel approach for treating disorders linked to this system.
| CAS Number | 1143578-94-2 |
| Synonyms | 4-[4-(3,4-difluorophenyl)pyrimidin-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide |
| Molecular Formula | C19H17F2N7O |
| Purity | ≥95% |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)pyrimidin-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide |
| InChI | InChI=1S/C19H17F2N7O/c20-14-4-3-13(12-15(14)21)16-5-7-22-18(24-16)27-8-10-28(11-9-27)19(29)25-17-2-1-6-23-26-17/h1-7,12H,8-11H2,(H,25,26,29) |
| InChIKey | JCWVFSJNIBAGQN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=CC(=N2)C3=CC(=C(C=C3)F)F)C(=O)NC4=NN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
