For research use only. Not for therapeutic Use.
Fagaronine chloride（Cat No.:I006758）is a naturally occurring alkaloid found in certain plant species, such as Fagara zanthoxyloides. It has been studied for its potential anticancer, antimicrobial, and anti-inflammatory properties. Fagaronine chloride exhibits cytotoxic effects against various cancer cell lines, potentially by inducing apoptosis and inhibiting cell proliferation. It has also shown antimicrobial activity, making it a candidate for addressing bacterial and fungal infections. Additionally, it is being investigated for its potential in modulating immune responses and for its neuroprotective effects. However, further research is needed to assess its clinical applicability and safety.
| Catalog Number | I006758 |
| CAS Number | 52259-64-0 (chloride) |
| Synonyms | Fagaronine chloride; NSC 157995; NSC-157995; NSC157995.;2-Hydroxy-3,8,9-trimethoxy-5-methylbenzo(c)phenanthridinium chloride |
| Molecular Formula | C21H20ClNO4 |
| Purity | ≥95% |
| Target | Topoisomerases I inhibitor. |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| IUPAC Name | 3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol;chloride |
| InChI | InChI=1S/C21H19NO4.ClH/c1-22-11-13-8-19(25-3)20(26-4)9-15(13)14-6-5-12-7-17(23)18(24-2)10-16(12)21(14)22;/h5-11H,1-4H3;1H |
| InChIKey | VVEPUJCLNRDIEQ-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC(=C(C=C4C=C3)O)OC)OC)OC.[Cl-] |
| Reference | 1:J Med Chem. 1985 Aug;28(8):1031-6. Synthesis and antitumor activity of structural analogues of the anticancer benzophenanthridine alkaloid fagaronine chloride.Cushman M,Mohan P, PMID: 4020826 </br><span>Abstract:</span> The indenoisoquinoline analogue 4 of fagaronine chloride (2) has been prepared, as well as its positional isomer 20 and the corresponding mesylated derivatives 16 and 19. Compounds 4, 16, and 20 were tested against P388 lymphocytic leukemia and found to possess significant activity. A tricyclic analogue 24 was also synthesized and was devoid of cytotoxicity in the KB cancer cell culture system. The change in the substitution pattern of the A-ring on going from 4 to 20 was tolerated without producing a significant decrease in antitumor activity. |
