For research use only. Not for therapeutic Use.
FAICAR (5-Formamidoimidazole-4-carboxamide ribonucleotide) is an intermediate in the purine biosynthesis pathway. This compound is crucial for the formation of adenine and guanine nucleotides. Its role in cellular metabolism and nucleotide synthesis makes it essential for DNA and RNA production, influencing cell growth and proliferation. Studying FAICAR provides insights into genetic disorders and potential therapeutic targets.
CAS Number | 13018-54-7 |
Synonyms | 5-Formylamino-4-imidazolecarboxamide Ribonucleotide; 5-(Formylamino)-1-(5-O-phosphono-β-D-ribofuranosyl)-1H-imidazole-4-carboxamide; 5-Formamido-1-β-D-ribofuranosyl-,5’-(dihydrogen phosphate)-imidazole-4-carboxamide |
Molecular Formula | C10H15N4O9P |
Purity | ≥95% |
Target | DNA/RNA Synthesis |
Storage | Desiccate at RT |
IUPAC Name | [(2R,3S,4R,5R)-5-(4-carbamoyl-5-formamidoimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
InChI | InChI=1S/C10H15N4O9P/c11-8(18)5-9(13-3-15)14(2-12-5)10-7(17)6(16)4(23-10)1-22-24(19,20)21/h2-4,6-7,10,16-17H,1H2,(H2,11,18)(H,13,15)(H2,19,20,21)/t4-,6-,7-,10-/m1/s1 |
InChIKey | ABCOOORLYAOBOZ-KQYNXXCUSA-N |
SMILES | C1=NC(=C(N1C2C(C(C(O2)COP(=O)(O)O)O)O)NC=O)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |