For research use only. Not for therapeutic Use.
Famoxadone (Cat No.:R039702) is a synthetic fungicide used in agriculture to protect crops from fungal diseases. Belonging to the quinone outside inhibitor (QoI) class, it disrupts fungal mitochondrial respiration, leading to their death. This fungicide is particularly effective against pathogens causing diseases like downy mildew and leaf-spotting diseases. Famoxadone plays a crucial role in integrated pest management strategies, ensuring crop protection and enhancing agricultural productivity by effectively combating fungal infections and preventing yield losses due to plant diseases.
| Catalog Number | R039702 |
| CAS Number | 131807-57-3 |
| Synonyms | Famoxate; DPX-JE 874; 5-Methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione; |
| Molecular Formula | C22H18N2O4 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | Room temperature |
| IUPAC Name | 3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione |
| InChI | InChI=1S/C22H18N2O4/c1-22(16-12-14-19(15-13-16)27-18-10-6-3-7-11-18)20(25)24(21(26)28-22)23-17-8-4-2-5-9-17/h2-15,23H,1H3 |
| InChIKey | PCCSBWNGDMYFCW-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)O1)NC2=CC=CC=C2)C3=CC=C(C=C3)OC4=CC=CC=C4 |
