For research use only. Not for therapeutic Use.
Fangchinoline（Cat No.:R065556）is a bisbenzylisoquinoline alkaloid derived from Stephania species, known for its diverse pharmacological properties. It exhibits anticancer, anti-inflammatory, neuroprotective, and antimicrobial activities, making it a valuable compound in drug discovery and biomedical research. Fangchinoline acts on multiple targets, including ion channels, signaling pathways, and apoptotic regulators, contributing to its therapeutic potential in conditions such as cancer, cardiovascular diseases, and neurodegenerative disorders. Its ability to modulate cellular processes highlights its importance in exploring natural product-based drug development and understanding complex disease mechanisms.
| Catalog Number | R065556 |
| CAS Number | 436-77-1 |
| Molecular Formula | C37H40N2O6 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Storage | Store at -20°C |
| IUPAC Name | (1S,14S)-9,20,25-trimethoxy-15,30-dimethyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18,20,22(33),24,26,31-dodecaen-21-ol |
| InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-32-18-23(8-11-30(32)41-3)17-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m0/s1 |
| InChIKey | IIQSJHUEZBTSAT-VMPREFPWSA-N |
| SMILES | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)O)OC)OC |
