For research use only. Not for therapeutic Use.
Fangchinoline(CAT: R065556) is a natural alkaloid compound found in certain Chinese medicinal herbs, including Stephania tetrandra. Its mode of action involves having various pharmacological properties, including anti-inflammatory, antiviral, and antitumor effects. Fangchinoline has been studied for its potential therapeutic applications, particularly in traditional medicine and herbal remedies. Researchers are interested in its potential as a lead compound for the development of new drugs and treatment options.
| Catalog Number | R065556 |
| CAS Number | 436-77-1 |
| Molecular Formula | C37H40N2O6 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-32-18-23(8-11-30(32)41-3)17-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m0/s1 |
| InChIKey | IIQSJHUEZBTSAT-VMPREFPWSA-N |
| SMILES | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)O)OC)OC |
