For research use only. Not for therapeutic Use.
Fanotaprim（Cat No.:I027273）is a potent and selective dihydrofolate reductase (DHFR) inhibitor, designed as a next-generation antifolate agent. It blocks the DHFR enzyme, essential for the synthesis of nucleotides required for DNA replication. By inhibiting DHFR, Fanotaprim disrupts the growth and replication of rapidly dividing cells, such as those in certain bacterial infections and cancers. Its enhanced specificity and reduced resistance compared to older antifolates make it a promising candidate for antimicrobial and anticancer therapies. Fanotaprim continues to be explored for its potential in overcoming drug resistance.
| Catalog Number | I027273 |
| CAS Number | 2120282-75-7 |
| Synonyms | Fanotaprim |
| Molecular Formula | C19H22N8O |
| Purity | 98% |
| Target | Antifolate |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 5-[4-[3-(2-methoxypyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C19H22N8O/c1-28-19-23-10-14(11-24-19)13-3-2-4-15(9-13)26-5-7-27(8-6-26)16-12-22-18(21)25-17(16)20/h2-4,9-12H,5-8H2,1H3,(H4,20,21,22,25) |
| InChIKey | GUZBZPCNAJDYMO-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=N1)C2=CC(=CC=C2)N3CCN(CC3)C4=CN=C(N=C4N)N |
