For research use only. Not for therapeutic Use.
Farnesyl pyrophosphate (Cat No.:M055792), also known as farnesyl diphosphate, is an important intermediate in the biosynthesis of sterols, including cholesterol, and various other isoprenoids. This molecule plays a crucial role in the prenylation of proteins, a process that attaches lipophilic molecules to proteins, thereby directing them to cellular membranes. FPP is formed from isopentenyl pyrophosphate and dimethylallyl pyrophosphate via the mevalonate pathway. Inhibiting its synthesis is a therapeutic target for treating diseases like cancer and osteoporosis, as well as for managing cholesterol levels due to its pivotal role in cellular functions.
| Catalog Number | M055792 |
| CAS Number | 13058-04-3 |
| Molecular Formula | C15H37N3O7P2 |
| Purity | ≥95% |
| Target | Membrane Transporter/Ion Channel |
| Storage | Desiccate at +4C |
| IUPAC Name | phosphono [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hydrogen phosphate |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+,15-11+ |
| InChIKey | VWFJDQUYCIWHTN-YFVJMOTDSA-N |
| SMILES | CC(=CCCC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C)C |
