For research use only. Not for therapeutic Use.
Faropenem daloxate（Cat No.:I001600）is a high-purity oral antibiotic belonging to the penem class, used extensively in pharmaceutical research and development. As a prodrug of faropenem, it is activated in the body to combat a broad spectrum of bacterial infections, particularly those resistant to other beta-lactam antibiotics. Its unique structure allows it to inhibit bacterial cell wall synthesis effectively, making it valuable in treating respiratory, urinary, and skin infections. Faropenem daloxate is essential in drug development, providing a reliable option for studying advanced antimicrobial therapies.
| Catalog Number | I001600 |
| CAS Number | 141702-36-5 |
| Synonyms | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| Molecular Formula | C17H19NO8S |
| Purity | ≥95% |
| Target | Antibiotic |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| InChI | InChI=1S/C17H19NO8S/c1-7(19)11-14(20)18-12(13(27-15(11)18)9-4-3-5-23-9)16(21)24-6-10-8(2)25-17(22)26-10/h7,9,11,15,19H,3-6H2,1-2H3/t7-,9-,11+,15-/m1/s1 |
| InChIKey | JQBKWZPHJOEQAO-DVPVEWDBSA-N |
| SMILES | CC1=C(OC(=O)O1)COC(=O)C2=C(SC3N2C(=O)C3C(C)O)C4CCCO4 |
