For research use only. Not for therapeutic Use.
Fasciculatin is a flavonoid.
| Catalog Number | I027282 |
| CAS Number | 37905-12-7 |
| Synonyms | Fasciculatin |
| Molecular Formula | C28H32O14 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4'-O-(2-O-Rhamnosylglucosyl)-genkwanin |
| InChI | InChI=1S/C25H34O4/c1-18(8-5-9-19(2)11-7-13-22-14-15-28-17-22)10-6-12-20(3)16-23-24(26)21(4)25(27)29-23/h5,8-9,14-18,20,26H,6-7,10-13H2,1-4H3/b8-5+,19-9+,23-16+/t18-,20+/m1/s1 |
| InChIKey | XZFNRHCNBWUYAM-JUXMFKGUSA-N |
| SMILES | C[C@@H](CCC[C@H](C)C=C/1OC(=O)C(=C1O)C)C=CC=C(/C)CCCc2cocc2 |
| Reference | 1. Narain NK. Flavonoids from Vernonia fasciculata Michx. Isolation of genkwanin and a new flavone disaccharide, fasciculatin. J Chem Soc Perkin 1. 1977;(9):I018-20. doi: 10.1002/chin.197731300. PMID: 559004. |
