For research use only. Not for therapeutic Use.
Fasentin (CAT: I006766) is an inhibitor of glucose uptake and a selective inhibitor of the glucose transporter GluT1. It sensitizes cells to FAS-induced cell death, selectively enhancing the response to death ligands. Fasentin affects the expression of genes related to nutrient and glucose deprivation. It interacts with a specific site within the intracellular channel of the glucose transport protein GLUT1. Fasentin’s mechanism of action involves modulating glucose uptake and cellular responses to death ligands, potentially making it useful in cancer therapy and understanding glucose metabolism.
| Catalog Number | I006766 |
| CAS Number | 392721-37-8 |
| Synonyms | Fasentin;N-[4-Chloro-3-(trifluoromethyl)phenyl]-3-oxobutanamide |
| Molecular Formula | C11H9ClF3NO2 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxobutanamide |
| InChI | InChI=1S/C11H9ClF3NO2/c1-6(17)4-10(18)16-7-2-3-9(12)8(5-7)11(13,14)15/h2-3,5H,4H2,1H3,(H,16,18) |
| InChIKey | GNYIJZMBLZXJEJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC(=C(C=C1)Cl)C(F)(F)F |
| Reference | </br> 1: Wood TE, Dalili S, Simpson CD, Hurren R, Mao X, Saiz FS, Gronda M, Eberhard Y, Minden MD, Bilan PJ, Klip A, Batey RA, Schimmer AD. A novel inhibitor of glucose uptake sensitizes cells to FAS-induced cell death. Mol Cancer Ther. 2008 Nov;7(11):3546-55. doi: 10.1158/1535-7163.MCT-08-0569. PubMed PMID: 19001437. |
