Fasudil monohydrochloride（Cat No.:A000787）is a potent Rho kinase inhibitor, primarily used to improve cerebral blood flow and reduce vascular resistance in conditions like vasospasm after subarachnoid hemorrhage. By inhibiting Rho kinase, fasudil promotes vasodilation and enhances endothelial function, making it beneficial in treating ischemic conditions. It has also shown promise in other therapeutic areas, including cardiovascular diseases and neurodegenerative disorders. Administered orally or intravenously, fasudil’s favorable safety profile and efficacy in enhancing cerebral perfusion position it as a valuable option in neuroprotective therapies and vascular management.
| Catalog Number | A000787 |
| CAS Number | 105628-07-7 |
| Synonyms | NA |
| Molecular Formula | C₁₄H₁₇N₃O₂S•HCl |
| Purity | ≥95% |
| Target | ROCK |
| Solubility | >16.4mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline;hydrochloride |
| InChI | InChI=1S/C14H17N3O2S.ClH/c18-20(19,17-9-2-6-15-8-10-17)14-4-1-3-12-11-16-7-5-13(12)14;/h1,3-5,7,11,15H,2,6,8-10H2;1H |
| InChIKey | LFVPBERIVUNMGV-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3.Cl |
