For research use only. Not for therapeutic Use.
FC-668 is a biochemical.
| Catalog Number | I027317 |
| CAS Number | 2014-31-5 |
| Synonyms | FC 668; FC668; FC-668 |
| Molecular Formula | C15H23Cl3N2O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-Piperazineacetic acid, alpha,4-dimethyl-, 6-chloro-o-tolyl ester, dihydrochloride |
| InChI | InChI=1S/C15H21ClN2O2.2ClH/c1-11-5-4-6-13(16)14(11)20-15(19)12(2)18-9-7-17(3)8-10-18;;/h4-6,12H,7-10H2,1-3H3;2*1H |
| InChIKey | MKCJSDJZKHOKBH-UHFFFAOYSA-N |
| SMILES | Cl.Cl.CC(N1CCN(C)CC1)C(=O)Oc2c(C)cccc2Cl |
