For research use only. Not for therapeutic Use.
FCCP (Cat No.:I003362) is an effective uncoupler of oxidative phosphorylation in mitochondria, disrupting ATP synthesis by transporting protons. FCCP is a protonophore (H+ ionophore) and an uncoupler of mitochondrial oxidative phosphorylation. It depolarizes the plasma and mitochondrial membranes. FCCP can affect various activities involved in cellular calcium ions.
| Catalog Number | I003362 |
| CAS Number | 370-86-5 |
| Synonyms | (4-(trifluoromethoxy)phenyl)carbonohydrazonoyl dicyanide |
| Molecular Formula | C₁₀H₅F₃N₄O |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO: ≥ 2.6 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 2-[[4-(trifluoromethoxy)phenyl]hydrazinylidene]propanedinitrile |
| InChI | InChI=1S/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H |
| InChIKey | BMZRVOVNUMQTIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN=C(C#N)C#N)OC(F)(F)F |
