For research use only. Not for therapeutic Use.
Feclemine (Cat No.: I027357) is a synthetic compound known for its potential as an inhibitor in neuropharmacology. Structurally classified as a propanediamine derivative, it has been investigated for its role in modulating neurotransmitter pathways. Studies suggest feclemine may act as an adrenergic or cholinergic receptor antagonist, influencing smooth muscle relaxation and neurotransmission. Its potential as a neuromodulatory inhibitor makes it relevant in research on spasmolytic agents. However, further studies are needed to confirm its efficacy and specificity in targeted inhibition mechanisms.
| CAS Number | 3590-16-7 |
| Synonyms | Feclemine; Spasmexan; UCB 1545; UCB1545; UCB-1545 |
| Molecular Formula | C24H42N2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-(alpha-Cyclohexylbenzyl)-N,N,N',N'-tetraethyl-1,3-propanediamine |
| InChI | InChI=1S/C24H42N2/c1-5-25(6-2)19-23(20-26(7-3)8-4)24(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9,11-12,15-16,22-24H,5-8,10,13-14,17-20H2,1-4H3 |
| InChIKey | QDMORDTWFMWOFA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(CN(CC)CC)C(C1CCCCC1)c2ccccc2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
