For research use only. Not for therapeutic Use.
Felodipine-d3(Cat No.:S000340) is a deuterated form of felodipine, where three hydrogen atoms are replaced with deuterium. Felodipine is a calcium channel blocker used primarily to treat hypertension by relaxing blood vessels and reducing heart workload. The addition of deuterium atoms to felodipine increases the molecule’s stability, allowing for more precise pharmacokinetic and metabolic studies. This isotopic labeling enhances the understanding of how felodipine is absorbed and metabolized in the body, leading to potential improvements in dosing accuracy, therapeutic efficacy, and the minimization of side effects for patients with high blood pressure.
CAS Number | 1219795-30-8 |
Molecular Formula | C18H16D3Cl2NO4 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | 5-O-ethyl 3-O-methyl 4-(2,3-dichloro-4,5,6-trideuteriophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
InChI | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3/i6D,7D,8D |
InChIKey | RZTAMFZIAATZDJ-AYBVGXBASA-N |
SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |