For research use only. Not for therapeutic Use.
Fenbendazole（Cat No.:A000223）is a broad-spectrum anthelmintic widely used in veterinary medicine for controlling intestinal parasites in animals, including nematodes, hookworms, and whipworms. It works by inhibiting microtubule formation in parasitic cells, disrupting their ability to absorb nutrients and reproduce. This action leads to effective parasite elimination, ensuring healthier livestock and pets. Fenbendazole is valued for its safety profile, making it suitable for regular deworming regimens across various species. Its versatility and efficacy have also sparked interest in experimental research for potential applications beyond veterinary use.
| Catalog Number | A000223 |
| CAS Number | 43210-67-9 |
| Synonyms | NA |
| Molecular Formula | C₁₅H₁₃N₃O₂S |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | 3 years -20C powder |
| IUPAC Name | methyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate |
| InChI | InChI=1S/C15H13N3O2S/c1-20-15(19)18-14-16-12-8-7-11(9-13(12)17-14)21-10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | HDDSHPAODJUKPD-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)SC3=CC=CC=C3 |
