For research use only. Not for therapeutic Use.
Fenhexamid（Cat No.:R047646）is a potent fungicide widely used in agricultural applications to control various fungal diseases, particularly in fruit and vegetable crops. It works by inhibiting the fungal cell membrane’s synthesis of sterols, which are essential for the growth and reproduction of fungi. Fenhexamid is effective against pathogens like Botrytis and Monilinia, which cause significant crop damage. Its targeted action helps reduce crop losses while minimizing environmental impact. Available in various formulations, Fenhexamid is an essential tool for integrated pest management in sustainable agriculture.
| Catalog Number | R047646 |
| CAS Number | 126833-17-8 |
| Synonyms | N-(2,3-Dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide; Decree; Elevate; KBR 2738; Teldor; |
| Molecular Formula | C14H17Cl2NO2 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | -20°C |
| IUPAC Name | N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide |
| InChI | InChI=1S/C14H17Cl2NO2/c1-14(7-3-2-4-8-14)13(19)17-9-5-6-10(18)12(16)11(9)15/h5-6,18H,2-4,7-8H2,1H3,(H,17,19) |
| InChIKey | VDLGAVXLJYLFDH-UHFFFAOYSA-N |
| SMILES | CC1(CCCCC1)C(=O)NC2=C(C(=C(C=C2)O)Cl)Cl |
