For research use only. Not for therapeutic Use.
Fenobam hydrate（Cat No.:I027397）is a selective antagonist of the metabotropic glutamate receptor 5 (mGluR5), which is involved in various neurological processes such as cognition, mood regulation, and synaptic plasticity. By blocking mGluR5, fenobam can modulate glutamate signaling, potentially offering therapeutic benefits in conditions like anxiety, depression, and certain neurodegenerative disorders. It has been investigated for its anxiolytic and antidepressant-like effects in preclinical studies. Fenobam hydrate is being studied for its role in treating fragile X syndrome, a genetic disorder associated with intellectual disability and behavioral issues, where mGluR5 modulation may provide symptom relief.
| Catalog Number | I027397 |
| CAS Number | 63540-28-3 |
| Synonyms | Fenobam hydrate |
| Molecular Formula | C11H13ClN4O3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (3E)-1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea;hydrate |
| InChI | InChI=1S/C11H11ClN4O2.H2O/c1-16-6-9(17)14-10(16)15-11(18)13-8-4-2-3-7(12)5-8;/h2-5H,6H2,1H3,(H2,13,14,15,17,18);1H2 |
| InChIKey | UNFQKKSADLVQJE-UHFFFAOYSA-N |
| SMILES | CN\1CC(=O)N/C1=N\C(=O)NC2=CC(=CC=C2)Cl.O |
| Reference | 1. Porter, R.H.P., Jaeschke, G., Spooren, W., et al. Fenobam: A clinically validated nonbenzodiazepine anxiolytic Is a potent, selective, and noncompetitive mGlu5 receptor antagonist with inverse agonist activity. J. Pharmacol. Exp. Ther. 315(2), 711-721 (2005). |
