For research use only. Not for therapeutic Use.
Fenobam(CAT: I006260) is a selective, non-competitive antagonist of the metabotropic glutamate receptor 5 (mGluR5). By inhibiting mGluR5, Fenobam modulates glutamatergic neurotransmission, which is implicated in various neurological and psychiatric disorders. Originally developed as an anxiolytic agent, Fenobam has shown potential in treating anxiety disorders, fragile X syndrome, and chronic pain conditions, such as migraine and neuropathic pain. Its ability to regulate excessive glutamate signaling also makes it a valuable tool in neuropharmacological research for studying neurodegenerative diseases and neurodevelopmental disorders.
| Catalog Number | I006260 |
| CAS Number | 57653-26-6 |
| Synonyms | Fenobam; NPL-2009; NPL2009; NPL 2009;1-(3-chlorophenyl)-3-(3-methyl-5-oxo-4H-imidazol-2-yl)urea |
| Molecular Formula | C11H11ClN4O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO, not in water |
| Storage | Store at RT |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3-methyl-5-oxo-4H-imidazol-2-yl)urea |
| InChI | InChI=1S/C11H11ClN4O2/c1-16-6-9(17)14-10(16)15-11(18)13-8-4-2-3-7(12)5-8/h2-5H,6H2,1H3,(H2,13,14,15,17,18) |
| InChIKey | DWPQODZAOSWNHB-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N=C1NC(=O)NC2=CC(=CC=C2)Cl |
