For research use only. Not for therapeutic Use.
Fenoxaprop-P-ethyl(CAT: I004662) is a selective post-emergence herbicide widely used in agricultural research and crop management to control annual and perennial grass weeds in broadleaf crops such as wheat, barley, and rice. It functions by inhibiting the enzyme acetyl-CoA carboxylase (ACCase), which is essential for fatty acid biosynthesis in grasses. This inhibition disrupts lipid metabolism, leading to the death of target weeds while leaving broadleaf crops unharmed. Fenoxaprop-P-ethyl is valued for its high selectivity and effectiveness in weed management, contributing to increased crop yields and sustainable farming practices.
CAS Number | 71283-80-2 |
Molecular Formula | C18H16ClNO5 |
Purity | ≥95% |
Solubility | 10 mM in DMSO |
Storage | Store at +4°C |
IUPAC Name | ethyl (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate |
InChI | InChI=1S/C18H16ClNO5/c1-3-22-17(21)11(2)23-13-5-7-14(8-6-13)24-18-20-15-9-4-12(19)10-16(15)25-18/h4-11H,3H2,1-2H3/t11-/m1/s1 |
InChIKey | PQKBPHSEKWERTG-LLVKDONJSA-N |
SMILES | CCOC(=O)[C@@H](C)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |