For research use only. Not for therapeutic Use.
Fenpropimorph(CAT: R047536) is a systemic fungicide and sterol biosynthesis inhibitor that targets the ergosterol pathway in fungi. By inhibiting sterol Δ14-reductase and Δ8→Δ7-isomerase enzymes, Fenpropimorph disrupts cell membrane formation, effectively halting fungal growth and reproduction. It is primarily used in agricultural research to study plant-pathogen interactions and fungicidal resistance mechanisms. Fenpropimorph also serves as a chemical probe for investigating sterol metabolism in both fungal and plant systems. Its unique mode of action makes it valuable for studying antifungal strategies and lipid biosynthesis.
| CAS Number | 67564-91-4 |
| Synonyms | (2R,6S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
| Molecular Formula | C20H33NO |
| Purity | ≥95% |
| IUPAC Name | (2R,6S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
| InChI | InChI=1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3/t15?,16-,17+ |
| InChIKey | RYAUSSKQMZRMAI-ALOPSCKCSA-N |
| SMILES | CC1CN(CC(O1)C)CC(C)CC2=CC=C(C=C2)C(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
