For research use only. Not for therapeutic Use.
Fenquizone(CAT: R043687) is a thiazide-like diuretic medication used to treat conditions such as hypertension (high blood pressure) and edema associated with heart failure or kidney disorders. It works by inhibiting sodium reabsorption in the kidneys, leading to increased urine production and the elimination of excess salt and water from the body. This helps to lower blood pressure and reduce fluid retention. Fenquizone, like other diuretics, can also be used to manage certain cases of fluid buildup (edema) resulting from liver or lung diseases. Its pharmacological profile and clinical applications make it valuable in managing cardiovascular and renal conditions.
| Catalog Number | R043687 |
| CAS Number | 20287-37-0 |
| Synonyms | 7-chloro-4-oxo-2-phenyl-2,3-dihydro-1H-quinazoline-6-sulfonamide |
| Molecular Formula | C14H12ClN3O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C14H12ClN3O3S/c15-10-7-11-9(6-12(10)22(16,20)21)14(19)18-13(17-11)8-4-2-1-3-5-8/h1-7,13,17H,(H,18,19)(H2,16,20,21) |
| InChIKey | DBDTUXMDTSTPQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2NC3=CC(=C(C=C3C(=O)N2)S(=O)(=O)N)Cl |
