For research use only. Not for therapeutic Use.
Fenticonazole Nitrate-d9 is a deuterated form of fenticonazole nitrate, an antifungal agent, featuring nine deuterium atoms. This isotopically labeled compound is particularly valuable in pharmaceutical research, especially for studying the pharmacokinetics, metabolism, and efficacy of antifungal treatments. The deuterium labeling enhances the precision and sensitivity of mass spectrometric analyses, allowing researchers to accurately track and quantify fenticonazole in biological systems. Fenticonazole Nitrate-d9 is essential for investigating the drug’s metabolic pathways, absorption, distribution, and excretion, contributing to the optimization of antifungal therapies. Its high purity and stability ensure reliable and consistent performance in advanced research applications, making it a crucial tool for scientists focused on developing and refining treatments for fungal infections.
| Catalog Number | R019229 |
| CAS Number | 72479-26-6 |
| Synonyms | 1-[2-(2,4-Dichlorophenyl)-2-[[4-(phenylthio)phenyl]methoxy]ethyl]-1H-imidazole?Nitrate-d9; Falvin-d9; Feniconazole Nitrate-d9; Fenticonazole Nitrate-d9; Fentiderm-d9; Lomexin Nitrate-d9; REC 15-1476-d9; |
| Molecular Formula | C24H20Cl2N2OS |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Store at +4C |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylsulfanylphenyl)methoxy]ethyl]imidazole |
| InChI | InChI=1S/C24H20Cl2N2OS/c25-19-8-11-22(23(26)14-19)24(15-28-13-12-27-17-28)29-16-18-6-9-21(10-7-18)30-20-4-2-1-3-5-20/h1-14,17,24H,15-16H2 |
| InChIKey | ZCJYUTQZBAIHBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=C(C=C2)COC(CN3C=CN=C3)C4=C(C=C(C=C4)Cl)Cl |
