For research use only. Not for therapeutic Use.
Ferrostatin-1 (Cat No.: R061385) is a potent, selective inhibitor of ferroptosis, a form of regulated cell death driven by iron-dependent lipid peroxidation. It functions by inhibiting lipid peroxidation, preventing oxidative damage to cellular membranes, and protecting cells from ferroptosis. Ferrostatin-1 has shown promise in various studies related to neurodegenerative diseases, ischemic injury, and cancer, where ferroptosis plays a role in tissue damage. By modulating this pathway, it could be a potential therapeutic strategy for conditions where ferroptosis contributes to disease progression.
| Catalog Number | R061385 |
| CAS Number | 347174-05-4 |
| Synonyms | 3-Amino-4-cyclohexylaminobenzoic Acid Ethyl Ester; Fer-1 |
| Molecular Formula | C₁₅H₂₂N₂O₂ |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | >9.8mg/mL in DMSO |
| Storage | Store at -20°C |
| InChI | InChI=1S/C15H22N2O2/c1-2-19-15(18)11-8-9-14(13(16)10-11)17-12-6-4-3-5-7-12/h8-10,12,17H,2-7,16H2,1H3 |
| InChIKey | UJHBVMHOBZBWMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)NC2CCCCC2)N |
