For research use only. Not for therapeutic Use.
FF-10502 is an orally active antimetabolite FF-10502 is able to enter the nucleus where it inhibits DNA polymerases, thereby preventing DNA synthesis and halting tumor cell proliferation.FF-10502 shows beneficial anticancer activity via a novel mechanism of action on dormant cells.
| Catalog Number | I027439 |
| CAS Number | 184302-49-6 |
| Synonyms | FF-10502; FF 10502; FF10502; FF-10502-01; FF 10502-01; FF10502-01; FF-1050201; FF 1050201; FF1050201; |
| Molecular Formula | C9H12FN3O3S |
| Purity | 98% |
| Target | Nucleoside Antimetabolite/Analog |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-amino-1-((2R,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrothiophen-2-yl)pyrimidin-2(1H)-one |
| InChI | InChI=1S/C9H12FN3O3S/c10-6-7(15)4(3-14)17-8(6)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6+,7-,8-/m1/s1 |
| InChIKey | NIDPJRZOVFIBQB-PXBUCIJWSA-N |
| SMILES | O=C1N([C@@H]2S[C@H](CO)[C@@H](O)[C@@H]2F)C=CC(N)=N1 |
| Reference | 1: Mima S, Kakinuma C, Higuchi T, Saeki K, Yamada T, Uematsu R, Ishino M, Kito N, |
