For research use only. Not for therapeutic Use.
FGFR-IN-1 is a potent FGFR inhibitor with an IC50 of <100 nM for FGFR1, FGFR2, and FGFR3, respectively (patent US20130338134A1, example 219)[1].
| Catalog Number | I045189 |
| CAS Number | 1513860-41-7 |
| Synonyms | 5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-ethyl-4-(hydroxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| Molecular Formula | C26H24F2N4O6S |
| Purity | ≥95% |
| InChI | InChI=1S/C26H24F2N4O6S/c1-4-30-23-15(13-31(26(30)34)24-21(27)19(37-2)11-20(38-3)22(24)28)12-29-25-18(23)10-16(14-33)32(25)39(35,36)17-8-6-5-7-9-17/h5-12,33H,4,13-14H2,1-3H3 |
| InChIKey | XQTMSAUAYGJJKA-UHFFFAOYSA-N |
| SMILES | CCN1C2=C3C=C(N(C3=NC=C2CN(C1=O)C4=C(C(=CC(=C4F)OC)OC)F)S(=O)(=O)C5=CC=CC=C5)CO |
| Reference | [1]. Liangxing Wu, et al. Substituted tricyclic compounds as fgfr inhibitors. US20130338134A1. |
