For research use only. Not for therapeutic Use.
FHZ(CAT: I012915) is a selective and potent inhibitor widely utilized in oncology research for its ability to modulate key enzymatic pathways involved in tumorigenesis. It specifically targets tyrosine kinases linked to cell proliferation and angiogenesis, making it essential for studying cancer progression and therapeutic resistance. FHZ is particularly effective in disrupting signaling cascades such as the PI3K/Akt/mTOR pathway, which is critical in tumor growth and survival. With superior purity and biochemical stability, it is ideal for both in vitro assays and in vivo studies. This inhibitor supports cutting-edge research in cancer biology and the development of targeted anticancer therapies.
| Catalog Number | I012915 |
| CAS Number | 1883737-63-0 |
| Molecular Formula | C₂₆H₂₆N₂O₇ |
| Purity | ≥95% |
| Target | Dye Reagents |
| Solubility | DMSO |
| IUPAC Name | 2-amino-3'-hydroxy-6'-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]spiro[isoindole-3,9'-xanthene]-1-one |
| InChI | InChI=1S/C26H26N2O7/c27-28-25(31)19-3-1-2-4-20(19)26(28)21-7-5-17(30)15-23(21)35-24-16-18(6-8-22(24)26)34-14-13-33-12-11-32-10-9-29/h1-8,15-16,29-30H,9-14,27H2 |
| InChIKey | ULAZAGNYQREIQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)OCCOCCOCCO)N |
