For research use only. Not for therapeutic Use.
Fiacitabine(CAT: I004600) is a nucleoside analog and antiviral agent known for its potential activity against various DNA viruses, including herpes simplex virus (HSV) and hepatitis B virus (HBV). As a cytosine derivative, it inhibits viral DNA polymerase, disrupting viral replication. Fiacitabine has been explored in preclinical and clinical studies for its efficacy in treating viral infections and certain cancers. Its high specificity and potency make it a valuable tool for antiviral research, drug discovery, and the development of innovative therapies targeting viral diseases and associated conditions.
CAS Number | 69123-90-6 |
Synonyms | 4-amino-1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
Molecular Formula | C9H11FIN3O4 |
Purity | ≥95% |
Target | HSV |
Solubility | DMSO: ≥ 37 mg/mL |
Storage | Store at -20°C |
IC50 | 2.5/12.6 nM (HSV1/2) |
IUPAC Name | 4-amino-1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
InChI | InChI=1S/C9H11FIN3O4/c10-5-6(16)4(2-15)18-8(5)14-1-3(11)7(12)13-9(14)17/h1,4-6,8,15-16H,2H2,(H2,12,13,17)/t4-,5+,6-,8-/m1/s1 |
InChIKey | GIMSJJHKKXRFGV-BYPJNBLXSA-N |
SMILES | C1=C(C(=NC(=O)N1[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)F)N)I |