Fialuridine-15N2,13C is a deuterium-labeled derivative of fialuridine, an antiviral nucleoside analogue used in research on hepatitis B virus (HBV) treatment. The 15N2 and 13C labels indicate the presence of two nitrogen-15 and one carbon-13 isotopes, enhancing its application in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy by providing improved resolution and accuracy. This labeled compound is valuable for studying the metabolism and pharmacokinetics of fialuridine, as well as investigating its interactions with viral enzymes and cellular mechanisms. It helps in optimizing drug formulations, understanding drug behavior in biological systems, and validating analytical methods in antiviral research.
| Catalog Number | R009441 |
| CAS Number | NA |
| Synonyms | 1-(2-Deoxy-2-fluoro-β-D-arabinofuranosyl)-5-iodo-2,4(1H,3H-pyrimi- dinedione-15N2,13C ;1-(2’-Deoxy-2’-fluoro-β-D-arabinofuranosyl) -5-iodouracil-15N2,13C; 5-Iodo-2’-fluoroarauracil-15N2,13C; FIAU-15N2,13C;? |
| Molecular Formula | C₈¹³CH₁₀FI¹⁵N₂O₅ |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodo(213C,1,3-15N2)pyrimidine-2,4-dione |
| InChI | InChI=1S/C9H10FIN2O5/c10-5-6(15)4(2-14)18-8(5)13-1-3(11)7(16)12-9(13)17/h1,4-6,8,14-15H,2H2,(H,12,16,17)/t4-,5+,6-,8-/m1/s1/i9+1,12+1,13+1 |
| InChIKey | IPVFGAYTKQKGBM-FALYIKKFSA-N |
| SMILES | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodo(213C,1,3-15N2)pyrimidine-2,4-dione |
