For research use only. Not for therapeutic Use.
Filapixant is a purinoreceptor antagonist extracted from patent WO2016091776A1, example 348. Filapixant is the active reference substance of Eliapixant[1].
| Catalog Number | I027474 |
| CAS Number | 1948232-63-0 |
| Synonyms | 3-[[(2R)-4-methylmorpholin-2-yl]methoxy]-5-(5-methyl-1,3-thiazol-2-yl)-N-[(1R)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide |
| Molecular Formula | C24H26F3N5O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C24H26F3N5O3S/c1-14-9-28-22(36-14)17-6-16(7-19(8-17)35-13-20-12-32(3)4-5-34-20)21(33)31-15(2)18-10-29-23(30-11-18)24(25,26)27/h6-11,15,20H,4-5,12-13H2,1-3H3,(H,31,33)/t15-,20-/m1/s1 |
| InChIKey | MROBUJILSMBILX-FOIQADDNSA-N |
| SMILES | CC1=CN=C(S1)C2=CC(=CC(=C2)OCC3CN(CCO3)C)C(=O)NC(C)C4=CN=C(N=C4)C(F)(F)F |
| Reference | [1]. Davenport AJ, et, al. 1,3-thiazol-2-yl substituted benzamides. WO2016091776A1. |
