For research use only. Not for therapeutic Use.
Filastatin(Cat No.:I012640)is a selective, small-molecule inhibitor of the enzyme PIKfyve, which plays a key role in phosphoinositide metabolism and intracellular vesicle trafficking. By inhibiting PIKfyve, Filastatin disrupts late endosomal/lysosomal function and autophagic processes, with potential implications for regulating cellular stress responses. It has shown promise in cancer research, particularly in targeting tumor growth and metastasis, by modulating cell survival mechanisms. Filastatin also holds potential for treating diseases related to dysregulated autophagy, such as neurodegenerative disorders and certain infections, offering a novel therapeutic approach.
CAS Number | 431996-53-1 |
Synonyms | (3-Chloro-4-methyl-phenyl)-[4-(4-nitro-phenyl)-piperazin-1-yl]-methanone |
Molecular Formula | C18H18ClN3O3 |
Purity | ≥95% |
Target | Fungal |
IUPAC Name | (3-chloro-4-methylphenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
InChI | InChI=1S/C18H18ClN3O3/c1-13-2-3-14(12-17(13)19)18(23)21-10-8-20(9-11-21)15-4-6-16(7-5-15)22(24)25/h2-7,12H,8-11H2,1H3 |
InChIKey | PNECWWUOUHGWQG-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)C(=O)N2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-])Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |