For research use only. Not for therapeutic Use.
Filgotinib(CAT: I000761) is a potent and selective Janus kinase 1 (JAK1) inhibitor designed for advanced research in inflammatory and autoimmune disorders. By targeting JAK1, it effectively modulates cytokine signaling pathways implicated in diseases such as rheumatoid arthritis, Crohn’s disease, and ulcerative colitis. Filgotinib’s high specificity minimizes off-target effects, ensuring precise experimental outcomes in molecular and cellular studies. Its consistent purity and stability make it an excellent choice for researchers investigating JAK-STAT pathway mechanisms and therapeutic approaches. Ideal for drug discovery, Filgotinib supports studies focused on cytokine regulation and immune system modulation.
| Catalog Number | I000761 |
| CAS Number | 1206161-97-8 |
| Synonyms | N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| Molecular Formula | C₂₁H₂₃N₅O₃S |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | DMSO: ≥ 34 mg/mL |
| Storage | Store at -20C |
| IC50 | 10/28/810/116 nM(JAK1/JAK2/JAK3/Tyk2) |
| IUPAC Name | N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| InChI | InChI=1S/C21H23N5O3S/c27-20(17-8-9-17)23-21-22-19-3-1-2-18(26(19)24-21)16-6-4-15(5-7-16)14-25-10-12-30(28,29)13-11-25/h1-7,17H,8-14H2,(H,23,24,27) |
| InChIKey | RIJLVEAXPNLDTC-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=NN3C(=N2)C=CC=C3C4=CC=C(C=C4)CN5CCS(=O)(=O)CC5 |
