For research use only. Not for therapeutic Use.
Filociclovir（Cat No.:I006792）, also known as MBX 400 and ZSM-162, is a potential antiviral drug that is being developed for the treatment of herpes simplex virus (HSV) infections. The drug is a prodrug of penciclovir, which is an established antiviral agent used for the treatment of HSV and varicella zoster virus infections. Filociclovir is designed to have improved pharmacokinetic properties compared to penciclovir, resulting in higher drug levels in the body and better efficacy against HSV.
| Catalog Number | I006792 |
| CAS Number | 632325-71-4 |
| Synonyms | MBX-400; MBX 400; MBX400; ZSM-162; ZSM 162; ZSM162 Filociclovir.;(Z)-2-amino-9-((2,2-bis(hydroxymethyl)cyclopropylidene)methyl)-1,9-dihydro-6H-purin-6-one |
| Molecular Formula | C11H13N5O3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | Store at -20°C |
| IUPAC Name | 2-amino-9-[(Z)-[2,2-bis(hydroxymethyl)cyclopropylidene]methyl]-3H-purin-6-one |
| InChI | InChI=1S/C11H13N5O3/c12-10-14-8-7(9(19)15-10)13-5-16(8)2-6-1-11(6,3-17)4-18/h2,5,17-18H,1,3-4H2,(H3,12,14,15,19)/b6-2- |
| InChIKey | KMUNHOKTIVSFRA-KXFIGUGUSA-N |
| SMILES | C1C(=CN2C=NC3=C2NC(=NC3=O)N)C1(CO)CO |
