For research use only. Not for therapeutic Use.
Fingolimod-d4(Cat No.:S000280) is a deuterated form of fingolimod, where four hydrogen atoms are replaced with deuterium, enhancing its molecular stability and making it an excellent internal standard for precise analytical methods such as mass spectrometry and NMR spectroscopy. Fingolimod is a sphingosine 1-phosphate receptor modulator used primarily to treat multiple sclerosis (MS). It works by sequestering lymphocytes in lymph nodes, preventing them from contributing to the autoimmune reaction in the central nervous system.
CAS Number | 1346747-38-3 |
Molecular Formula | C19H29D4NO2 |
Purity | ≥95% |
Target | Cytoskeleton |
IUPAC Name | 2-amino-1,1,3,3-tetradeuterio-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol |
InChI | InChI=1S/C19H33NO2/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(20,15-21)16-22/h9-12,21-22H,2-8,13-16,20H2,1H3/i15D2,16D2 |
InChIKey | KKGQTZUTZRNORY-ONNKGWAKSA-N |
SMILES | CCCCCCCCC1=CC=C(C=C1)CCC(CO)(CO)N |