For research use only. Not for therapeutic Use.
Fipronil（Cat No.:H000073）, is a synthetic insecticide and acaricide used to control a wide range of pests in agriculture, horticulture, and public health applications. It works by disrupting the central nervous system of insects and mites, leading to paralysis and death. Fipronil is utilized in various formulations, including sprays, granules, and baits, making it effective against termites, ants, cockroaches, and crop-damaging insects.
| Catalog Number | H000073 |
| CAS Number | 120068-37-3 |
| Synonyms | 5-Amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile; (+/-)-Fipronil; 1-(2,6-Dichloro-4-trifluoromethylphenyl)-3-cyano-5-amino-4-(trifluoromethylsulfinyl)pyrazole; Fluocyanobenpyrazole; |
| Molecular Formula | C12H4Cl2F6N4OS |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | 2-8°C |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazole-3-carbonitrile |
| InChI | InChI=1S/C12H4Cl2F6N4OS/c13-5-1-4(11(15,16)17)2-6(14)8(5)24-10(22)9(7(3-21)23-24)26(25)12(18,19)20/h1-2H,22H2 |
| InChIKey | ZOCSXAVNDGMNBV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C#N)S(=O)C(F)(F)F)N)Cl)C(F)(F)F |
| Reference | 1.Fipronil Technical Fact Sheet./ National Pesticide Information Center. United States Environmental Protection Agency, 2009. Web. 2016. |
