For research use only. Not for therapeutic Use.
Fisetin(Cat No.:R015004), is a natural flavonol compound found in various fruits and vegetables, including strawberries, apples, and onions. It is known for its antioxidant and anti-inflammatory properties, which contribute to its potential health benefits. Fisetin has garnered interest in scientific research due to its potential neuroprotective effects, including its role in promoting brain health and potentially mitigating cognitive decline. Additionally, fisetin has been investigated for its anticancer properties and potential use in cancer prevention and treatment.
Catalog Number | R015004 |
CAS Number | 528-48-3 |
Synonyms | 2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-4H-benzopyran-4-one; 3,3’,4’,7-Tetrahydroxyflavone; 5-Desoxyquercetin; Bois Bleu de Honqrie; C.I. 75620; C.I. Natural Brown 1; Cotinin; Fiestin; Fietin; Fisetholz; Fisitin; Fustel; Fustet; Junger Ustik; LDN 00583 |
Molecular Formula | C15H10O6 |
Purity | ≥95% |
Documentation | |
Target | Epigenetics |
Storage | -20°C |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one |
InChI | InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
InChIKey | XHEFDIBZLJXQHF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |