For research use only. Not for therapeutic Use.
FIT-039（Cat No.:I015336）is a novel compound designed as a selective inhibitor of the enzyme protein kinase C (PKC), particularly targeting the PKCδ isoform. This compound has garnered interest for its potential therapeutic applications in cancer and inflammatory diseases, as PKCδ is implicated in various cellular processes, including cell proliferation and survival. Preclinical studies suggest that FIT-039 can induce apoptosis in cancer cells and reduce inflammation in animal models. Its specificity and potency position it as a valuable tool for further research, with the potential for development into a therapeutic agent for multiple diseases.
| Catalog Number | I015336 |
| CAS Number | 1113044-49-7 |
| Molecular Formula | C₁₇H₁₈FN₃S |
| Purity | ≥95% |
| IUPAC Name | N-(5-fluoro-2-piperidin-1-ylphenyl)pyridine-4-carbothioamide |
| InChI | InChI=1S/C17H18FN3S/c18-14-4-5-16(21-10-2-1-3-11-21)15(12-14)20-17(22)13-6-8-19-9-7-13/h4-9,12H,1-3,10-11H2,(H,20,22) |
| InChIKey | VRKZHYSJZOUICG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)F)NC(=S)C3=CC=NC=C3 |
| Reference | [1]. Makoto Yamamoto, et al. CDK9 Inhibitor FIT-039 Prevents Replication of Multiple DNA Viruses. J Clin Invest. 2014 Aug;124(8):3479-88. |
