For research use only. Not for therapeutic Use.
FK-330 is a pharmaceutical compound known for its immunosuppressive properties, developed as part of the broader class of immunosuppressants similar to tacrolimus. It is primarily researched for its potential in preventing organ transplant rejection and treating autoimmune diseases. FK-330 functions by inhibiting calcineurin, a key enzyme in the activation of T-cells, thereby reducing the immune response. This mechanism of action makes it valuable in clinical settings where immune modulation is necessary. However, as with other immunosuppressants, its use requires careful management due to the risk of infections and other side effects.
| Catalog Number | I006800 |
| CAS Number | 442198-67-6 (FK-330) ; 682813-92-9(FK-330 dihydrate) |
| Synonyms | FK-330; FK 330; FK330; UNII-K47C68D94B; FR-260330; SCHEMBL4918744; K47C68D94B; FK-330; LS-192510.;2-Pyridinepropanamide, alpha-(((2E)-3-(4-chlorophenyl)-1-oxo-2-propen-1-yl)amino)-N-(2-oxo-2-(4-((6-(trifluoromethyl)-4-pyrimidinyl)oxy)-1-piperidinyl)e |
| Molecular Formula | C29H28ClF3N6O4 |
| Purity | ≥95% |
| Target | nitric oxide synthase inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| SMILES | c1ccnc(c1)C[C@@H](C(=O)NCC(=O)N2CCC(CC2)Oc3cc(ncn3)C(F)(F)F)NC(=O)/C=C/c4ccc(cc4)Cl |
