For research use only. Not for therapeutic Use.
FK-866（Cat No.:I004482）is a highly potent inhibitor of nicotinamide phosphoribosyltransferase (NAMPT), a key enzyme in the NAD+ biosynthesis pathway. By depleting cellular NAD+ levels, FK-866 disrupts energy metabolism and induces apoptosis, particularly in rapidly proliferating cancer cells. It has been studied extensively for its potential in cancer therapy, especially in tumors with high metabolic demands. FK-866’s mechanism of action also makes it a valuable tool for studying metabolic pathways and cell death processes, providing insight into novel therapeutic approaches for cancer treatment.
| Catalog Number | I004482 |
| CAS Number | 658084-64-1 |
| Synonyms | (E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
| Molecular Formula | C₂₄H₂₉N₃O₂ |
| Purity | ≥95% |
| Target | Transferase |
| Solubility | DMSO: 25 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 0.09 nM |
| IUPAC Name | (E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
| InChI | InChI=1S/C24H29N3O2/c28-23(12-11-21-8-6-15-25-19-21)26-16-5-4-7-20-13-17-27(18-14-20)24(29)22-9-2-1-3-10-22/h1-3,6,8-12,15,19-20H,4-5,7,13-14,16-18H2,(H,26,28)/b12-11+ |
| InChIKey | KPBNHDGDUADAGP-VAWYXSNFSA-N |
| SMILES | C1CN(CCC1CCCCNC(=O)/C=C/C2=CN=CC=C2)C(=O)C3=CC=CC=C3 |
| Reference | <p style=/line-height:25px/> |
