For research use only. Not for therapeutic Use.
FKGK18（Cat No.:I012637）is a peptide that functions as a selective inhibitor or modulator in various biological processes. It is often studied for its potential in modulating protein-protein interactions, particularly those related to cell signaling, inflammation, and immune responses. The peptide contains key sequences that allow it to bind specifically to target proteins, interfering with their normal function. FKGK18 is being researched for its therapeutic applications in diseases like cancer, autoimmune disorders, and chronic inflammation. Its precise mechanism and therapeutic potential are under ongoing investigation in preclinical and clinical studies.
| CAS Number | 1071001-09-6 |
| Synonyms | 1,1,1-trifluoro-6-naphthalen-2-ylhexan-2-one |
| Molecular Formula | C16H15F3O |
| Purity | ≥95% |
| IUPAC Name | 1,1,1-trifluoro-6-naphthalen-2-ylhexan-2-one |
| InChI | InChI=1S/C16H15F3O/c17-16(18,19)15(20)8-4-1-5-12-9-10-13-6-2-3-7-14(13)11-12/h2-3,6-7,9-11H,1,4-5,8H2 |
| InChIKey | VCWWTQMRNJSJGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CCCCC(=O)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
