For research use only. Not for therapeutic Use.
Flavine adenine dinucleotide (FAD) is a crucial coenzyme derived from riboflavin (vitamin B2). It plays an essential role in various redox reactions within the cell, acting as an electron carrier in metabolic processes such as the citric acid cycle and oxidative phosphorylation. FAD is vital for energy production, converting nutrients into ATP. Research focuses on its function in cellular metabolism, its involvement in mitochondrial function, and its potential therapeutic applications in metabolic disorders.
CAS Number | 146-14-5 |
Molecular Formula | C27H33N9O15P2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] hydrogen phosphate |
InChI | InChI=1S/C27H33N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H,34,42,43)/t14-,15+,16+,19-,20+,21+,26+/m0/s1 |
InChIKey | VWWQXMAJTJZDQX-UYBVJOGSSA-N |
SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)N5C=NC6=C5N=CN=C6N)O)O)O)O)O |