For research use only. Not for therapeutic Use.
Flaviviruses-IN-3 (compound 87) is a potent flaviviruse inhibitor. Flaviviruses-IN-3 reduces the WNV (West Nile virus) protease activity, with a inhibition of 54%[1].
| Catalog Number | I041708 |
| CAS Number | 420090-97-7 |
| Synonyms | N-[4-(acetylsulfamoyl)phenyl]-2-(4-ethylphenyl)quinoline-4-carboxamide |
| Molecular Formula | C26H23N3O4S |
| Purity | ≥95% |
| InChI | InChI=1S/C26H23N3O4S/c1-3-18-8-10-19(11-9-18)25-16-23(22-6-4-5-7-24(22)28-25)26(31)27-20-12-14-21(15-13-20)34(32,33)29-17(2)30/h4-16H,3H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | BFDIEQUQKQXLAS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)NC4=CC=C(C=C4)S(=O)(=O)NC(=O)C |
| Reference | [1]. Radhakrishnan Padmanabhan, et al. Flavivirus inhibitors and methods for their use. WO2010039538. |
