For research use only. Not for therapeutic Use.
Flavokawain B (Cat.No:R029117) is a natural chalcone compound found in the kava plant. It possesses notable bioactivities, including anticancer and anti-inflammatory properties. Flavokawain B has shown potential in inhibiting the growth of cancer cells and inducing apoptosis. Its diverse pharmacological effects make it a subject of ongoing research for therapeutic applications.
CAS Number | 1775-97-9 |
Molecular Formula | C17H16O4 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
InChI | InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+ |
InChIKey | QKQLSQLKXBHUSO-CMDGGOBGSA-N |
SMILES | COC1=CC(=C(C(=C1)OC)C(=O)C=CC2=CC=CC=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |