For research use only. Not for therapeutic Use.
Flavone is a naturally occurring organic compound belonging to the flavonoid class of polyphenolic compounds. It is found in various plants and exhibits antioxidant, anti-inflammatory, and anticancer properties. Flavone’s structure consists of a benzene ring fused to a heterocyclic pyran ring. It serves as a precursor in the synthesis of flavonoids and pharmaceuticals, contributing to its importance in medicinal chemistry and natural product research.
CAS Number | 525-82-6 |
Synonyms | 2-Phenyl-4-chromone; 2-Phenyl-4H-1-benzopyran-4-one; 2-Phenyl-4H-benzopyran-4-one; 2-Phenyl-4H-chromen-4-one; 2-Phenyl-γ-benzopyrone; 2-Phenylchromen-4-one; 2-Phenylchromone; 94166III?Asmacoril; Chromocor; Cromaril; NSC 19028 |
Molecular Formula | C15H10O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 2-phenylchromen-4-one |
InChI | InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
InChIKey | VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |