For research use only. Not for therapeutic Use.
Flavopiridol（Cat No.:I001773）is a synthetic flavonoid and potent cyclin-dependent kinase (CDK) inhibitor used in cancer research. By inhibiting CDKs, Flavopiridol disrupts the cell cycle, leading to cell cycle arrest and apoptosis in cancer cells. It shows efficacy against various malignancies, including leukemia, lymphoma, and solid tumors. Flavopiridol’s ability to sensitize cancer cells to chemotherapy and overcome drug resistance makes it a valuable adjunct in cancer treatment regimens. Its role in targeting key regulatory pathways underscores its potential in advancing cancer therapeutics and improving patient outcomes.
| Catalog Number | I001773 |
| CAS Number | 146426-40-6 |
| Synonyms | Alvocidib; Flavopiridol; HL 275; HL-275; HMR 1275; HMR-1275; L 86 8275; L86-8275; MDL 107,826A; MDL 107826A; MDL-107826A; NSC 649890. |
| Molecular Formula | C₂₁H₂₀ClNO₅ |
| Purity | ≥95% |
| Target | Cyclin-Dependent Kinases |
| Solubility | DMSO ≥14mg/mL Water <1.2mg/mL Ethanol ≥7.8mg/mL |
| Storage | -20°C |
| IC50 | ~ 40 nM |
| IUPAC Name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]chromen-4-one |
| InChI | InChI=1S/C21H20ClNO5/c1-23-7-6-12(17(27)10-23)19-14(24)8-15(25)20-16(26)9-18(28-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,17,24-25,27H,6-7,10H2,1H3/t12-,17+/m0/s1 |
| InChIKey | BIIVYFLTOXDAOV-YVEFUNNKSA-N |
| SMILES | CN1CCC(C(C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O |
