For research use only. Not for therapeutic Use.
Flezelastine（Cat No.:M108401）, is a chemical compound known in scientific contexts, particularly within the domain of medicinal chemistry. This compound is synthesized for experimental and potential therapeutic uses. The structural and pharmacological properties of flezelastine suggest it might be used in the study of biochemical pathways or drug development processes, possibly focusing on mechanisms such as inflammation or allergic responses.
| Catalog Number | M108401 |
| CAS Number | 135381-77-0 |
| Molecular Formula | C29H30FN3O |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-2-[1-(2-phenylethyl)azepan-4-yl]phthalazin-1-one |
| InChI | InChI=1S/C29H30FN3O/c30-24-14-12-23(13-15-24)21-28-26-10-4-5-11-27(26)29(34)33(31-28)25-9-6-18-32(20-17-25)19-16-22-7-2-1-3-8-22/h1-5,7-8,10-15,25H,6,9,16-21H2 |
| InChIKey | HQFSNUYUXXPVKL-UHFFFAOYSA-N |
| SMILES | C1CC(CCN(C1)CCC2=CC=CC=C2)N3C(=O)C4=CC=CC=C4C(=N3)CC5=CC=C(C=C5)F |
