For research use only. Not for therapeutic Use.
Flonicamid is an innovative insecticide used in agricultural research for its selective action against piercing-sucking pests. Its unique mode of action disrupts insect feeding behavior, ensuring effective pest control with minimal impact on beneficial insects. This compound is essential for developing sustainable and integrated pest management strategies, providing reliable results for advanced agronomic studies.
| Catalog Number | R017345 |
| CAS Number | 158062-67-0 |
| Synonyms | IKI 220; N-Cyanomethyl-4-trifluoromethyl-3-pyridinecarboxamide; Teppeki; Ulala; Aria; Beleaf; Carbine; Carbine (insecticide); F 1785; F 1785-03-1; N-(Cyanomethyl)-4-(trifluoromethyl)-3-pyridinecarboxamide; |
| Molecular Formula | C9H6F3N3O |
| Purity | ≥95% |
| Target | Parasite |
| Storage | -20°C |
| IUPAC Name | N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| InChIKey | RLQJEEJISHYWON-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)C(=O)NCC#N |
