For research use only. Not for therapeutic Use.
Flortaucipir F18 (18F-AV-1451 or T807) is a positron emission tomography (PET) imaging agent used to detect abnormal tau protein aggregates in the brain. These aggregates are associated with neurodegenerative diseases like Alzheimer’s disease and other tauopathies. Flortaucipir F18 binds to these tau deposits, allowing their visualization through PET scans. This imaging technique provides valuable insights into the distribution and extent of tau pathology in the brain, aiding in the diagnosis, monitoring, and research of neurodegenerative diseases. It has the potential to facilitate early detection and the development of targeted treatments for these conditions.
Catalog Number | I048033 |
CAS Number | 1522051-90-6 |
Synonyms | Flortaucipir F-18 |
Molecular Formula | C16H10FN3 |
Purity | ≥95% |
Target | MAPT |
Target Protein | |
Appearance | Solid |
IUPAC Name | 7-(6-(18F)fluoranylpyridin-3-yl)-5H-pyrido[4,3-b]indole |
InChI | InChI=1S/C16H10FN3/c17-16-4-2-11(8-19-16)10-1-3-12-13-9-18-6-5-14(13)20-15(12)7-10/h1-9,20H/i17-1 |
InChIKey | GETAAWDSFUCLBS-SJPDSGJFSA-N |
SMILES | C1=CC2=C(C=C1C3=CN=C(C=C3)F)NC4=C2C=NC=C4 |