For research use only. Not for therapeutic Use.
FLT3-IN-10 (compound 7c) is a potent inhibitor of FMS-like tyrosine kinase 3 (FLT3). FLT3-IN-10 has the potential for the research of FLT3-mutated acute myeloid leukemia (AML)[1].
| Catalog Number | I045297 |
| CAS Number | 2088735-51-5 |
| Synonyms | 5-(4-fluorophenyl)-N-phenyl-1,3-oxazol-2-amine |
| Molecular Formula | C15H11FN2O |
| Purity | ≥95% |
| InChI | InChI=1S/C15H11FN2O/c16-12-8-6-11(7-9-12)14-10-17-15(19-14)18-13-4-2-1-3-5-13/h1-10H,(H,17,18) |
| InChIKey | JNXCCEMGDXSTBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(O2)C3=CC=C(C=C3)F |
| Reference | [1]. Kim HJ, et al. Discovery of Oxazol-2-amine Derivatives as Potent Novel FLT3 Inhibitors. Molecules. 2020;25(21):5154. |
