For research use only. Not for therapeutic Use.
FluazinamR(Cat No.:R055910) is a chemical compound belonging to the class of pyridinamine fungicides. Its mode of action and pharmacological effects involve its interactions with fungal enzymes and cellular processes due to its specific chemical structure. Fluazinam acts by inhibiting the succinate dehydrogenase enzyme complex in the mitochondrial respiratory chain of fungi, leading to disruption of energy production and ultimately causing fungal cell death. It is used as a protective fungicide to control various fungal diseases in crops, including fruits, vegetables, and ornamental plants. Fluazinam’s significance lies in its role in integrated pest management strategies, contributing to enhanced agricultural productivity and preventing crop losses caused by fungal infections.
CAS Number | 79622-59-6 |
Synonyms | 3-Chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2-pyridinamine; ASC 66825; ASC 67178; Altima; Fluazinam; Frowncide; Frowncide SC; N-(3-Chloro-5-trifluoromethyl-2-pyridyl)-2,6-dinitro-3-chloro-4-trifluoromethylaniline; |
Molecular Formula | C13H4Cl2F6N4O4 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
InChI | InChI=1S/C13H4Cl2F6N4O4/c14-6-1-4(12(16,17)18)3-22-11(6)23-9-7(24(26)27)2-5(13(19,20)21)8(15)10(9)25(28)29/h1-3H,(H,22,23) |
InChIKey | UZCGKGPEKUCDTF-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1Cl)NC2=C(C=C(C(=C2[N+](=O)[O-])Cl)C(F)(F)F)[N+](=O)[O-])C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |